C32H37Cl2N5O7 — CID 90208297
(2,5-dioxopyrrolidin-1-yl) 4-[[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methylamino]-4-oxobutanoate (PubChem CID 90208297) has the molecular formula C32H37Cl2N5O7 and a molecular weight of 674.58 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methylamino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 90208297 |
| Molecular Formula | C32H37Cl2N5O7 |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 673.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)ON1C(=O)CCC1=O)NCC1CC(=O)Nc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc21 |
| InChI | InChI=1S/C32H37Cl2N5O7/c33-24-4-3-5-26(32(24)34)38-15-13-37(14-16-38)12-1-2-17-45-22-6-7-23-21(18-28(41)36-25(23)19-22)20-35-27(40)8-11-31(44)46-39-29(42)9-10-30(39)43/h3-7,19,21H,1-2,8-18,20H2,(H,35,40)(H,36,41) |
| InChIKey | SMCQUMQAHRGYBC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|