C24H30Cl2N4O3 — CID 21073544
7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-4-hydroxy-3,3-dimethyl-1,4-dihydro-1,8-naphthyridin-2-one (PubChem CID 21073544) has the molecular formula C24H30Cl2N4O3 and a molecular weight of 493.44 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-4-hydroxy-3,3-dimethyl-1,4-dihydro-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-4-hydroxy-3,3-dimethyl-1,4-dihydro-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 21073544 |
| Molecular Formula | C24H30Cl2N4O3 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-4-hydroxy-3,3-dimethyl-1,4-dihydro-1,8-naphthyridin-2-one |
| SMILES | CC1(C)C(=O)Nc2nc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2C1O |
| InChI | InChI=1S/C24H30Cl2N4O3/c1-24(2)21(31)16-8-9-19(27-22(16)28-23(24)32)33-15-4-3-10-29-11-13-30(14-12-29)18-7-5-6-17(25)20(18)26/h5-9,21,31H,3-4,10-15H2,1-2H3,(H,27,28,32) |
| InChIKey | PALFINKJYQPFGG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|