C27H32N4O3 — CID 21073347
4,4-dimethyl-7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-1H-pyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 21073347) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4,4-dimethyl-7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-1H-pyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | 4,4-dimethyl-7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-1H-pyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 21073347 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 4,4-dimethyl-7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-1H-pyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | CC1(C)OC(=O)Nc2nc(OCCCCN3CCN(c4cccc5ccccc45)CC3)ccc21 |
| InChI | InChI=1S/C27H32N4O3/c1-27(2)22-12-13-24(28-25(22)29-26(32)34-27)33-19-6-5-14-30-15-17-31(18-16-30)23-11-7-9-20-8-3-4-10-21(20)23/h3-4,7-13H,5-6,14-19H2,1-2H3,(H,28,29,32) |
| InChIKey | NRLLCMBRLIGKTM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|