C30H37N4O4P — CID 129274156
[7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl 2-methylphosphanylacetate (PubChem CID 129274156) has the molecular formula C30H37N4O4P and a molecular weight of 548.62 g/mol. Its IUPAC name is [7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl 2-methylphosphanylacetate.
| Compound Name | [7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl 2-methylphosphanylacetate |
|---|---|
| PubChem CID | 129274156 |
| Molecular Formula | C30H37N4O4P |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | [7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl 2-methylphosphanylacetate |
| SMILES | CPCC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc5ccccc45)CC3)nc21 |
| InChI | InChI=1S/C30H37N4O4P/c1-39-21-29(36)38-22-34-28(35)14-12-24-11-13-27(31-30(24)34)37-20-5-4-15-32-16-18-33(19-17-32)26-10-6-8-23-7-2-3-9-25(23)26/h2-3,6-11,13,39H,4-5,12,14-22H2,1H3 |
| InChIKey | YEFQTNGZJSUHQY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|