C29H39N5O3 — CID 69419386
tert-butyl N-[[2-amino-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-3-pyridinyl]methyl]carbamate (PubChem CID 69419386) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is tert-butyl N-[[2-amino-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-3-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-amino-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 69419386 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | tert-butyl N-[[2-amino-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-3-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(OCCCCN2CCN(c3cccc4ccccc34)CC2)nc1N |
| InChI | InChI=1S/C29H39N5O3/c1-29(2,3)37-28(35)31-21-23-13-14-26(32-27(23)30)36-20-7-6-15-33-16-18-34(19-17-33)25-12-8-10-22-9-4-5-11-24(22)25/h4-5,8-14H,6-7,15-21H2,1-3H3,(H2,30,32)(H,31,35) |
| InChIKey | IGMSMXHVTVPABC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|