C29H34N4O5S — CID 129274152
methylsulfanyl [7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl carbonate (PubChem CID 129274152) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is methylsulfanyl [7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl carbonate.
| Compound Name | methylsulfanyl [7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl carbonate |
|---|---|
| PubChem CID | 129274152 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | methylsulfanyl [7-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl]methyl carbonate |
| SMILES | CSOC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc5ccccc45)CC3)nc21 |
| InChI | InChI=1S/C29H34N4O5S/c1-39-38-29(35)37-21-33-27(34)14-12-23-11-13-26(30-28(23)33)36-20-5-4-15-31-16-18-32(19-17-31)25-10-6-8-22-7-2-3-9-24(22)25/h2-3,6-11,13H,4-5,12,14-21H2,1H3 |
| InChIKey | DIDBHPZYKZBCDM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|