C25H33Cl2N3O2 — CID 174683503
2-[[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]phenyl]methyl]morpholine (PubChem CID 174683503) has the molecular formula C25H33Cl2N3O2 and a molecular weight of 478.46 g/mol. Its IUPAC name is 2-[[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]phenyl]methyl]morpholine.
| Compound Name | 2-[[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 174683503 |
| Molecular Formula | C25H33Cl2N3O2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 2-[[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]phenyl]methyl]morpholine |
| SMILES | Clc1cccc(N2CCN(CCCCOc3ccc(CC4CNCCO4)cc3)CC2)c1Cl |
| InChI | InChI=1S/C25H33Cl2N3O2/c26-23-4-3-5-24(25(23)27)30-14-12-29(13-15-30)11-1-2-16-31-21-8-6-20(7-9-21)18-22-19-28-10-17-32-22/h3-9,22,28H,1-2,10-19H2 |
| InChIKey | MGNXHYDXGQDCNM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|