C29H38Cl2N4O5 — CID 166691032
[N-acetyl-5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylanilino]methyl morpholine-4-carboxylate (PubChem CID 166691032) has the molecular formula C29H38Cl2N4O5 and a molecular weight of 593.55 g/mol. Its IUPAC name is [N-acetyl-5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylanilino]methyl morpholine-4-carboxylate.
| Compound Name | [N-acetyl-5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylanilino]methyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 166691032 |
| Molecular Formula | C29H38Cl2N4O5 |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | [N-acetyl-5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylanilino]methyl morpholine-4-carboxylate |
| SMILES | CC(=O)N(COC(=O)N1CCOCC1)c1cc(OCCCCN2CCN(c3cccc(Cl)c3Cl)CC2)ccc1C |
| InChI | InChI=1S/C29H38Cl2N4O5/c1-22-8-9-24(20-27(22)35(23(2)36)21-40-29(37)34-15-18-38-19-16-34)39-17-4-3-10-32-11-13-33(14-12-32)26-7-5-6-25(30)28(26)31/h5-9,20H,3-4,10-19,21H2,1-2H3 |
| InChIKey | YGVSAZAPLMLNTL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|