C34H48ClN3O5 — CID 129274309
[5-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butoxy]-N-methyl-2-[(Z)-3-oxoprop-1-enyl]anilino]methyl 2,3,3-trimethylbutan-2-yl carbonate (PubChem CID 129274309) has the molecular formula C34H48ClN3O5 and a molecular weight of 614.23 g/mol. Its IUPAC name is [5-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butoxy]-N-methyl-2-[(Z)-3-oxoprop-1-enyl]anilino]methyl 2,3,3-trimethylbutan-2-yl carbonate.
| Compound Name | [5-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butoxy]-N-methyl-2-[(Z)-3-oxoprop-1-enyl]anilino]methyl 2,3,3-trimethylbutan-2-yl carbonate |
|---|---|
| PubChem CID | 129274309 |
| Molecular Formula | C34H48ClN3O5 |
| Molecular Weight | 614.23 g/mol |
| Exact Mass | 613.33 |
| IUPAC Name | [5-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butoxy]-N-methyl-2-[(Z)-3-oxoprop-1-enyl]anilino]methyl 2,3,3-trimethylbutan-2-yl carbonate |
| SMILES | Cc1c(Cl)cccc1N1CCN(CCCCOc2ccc(/C=C\C=O)c(N(C)COC(=O)OC(C)(C)C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C34H48ClN3O5/c1-26-29(35)13-10-14-30(26)38-20-18-37(19-21-38)17-8-9-23-41-28-16-15-27(12-11-22-39)31(24-28)36(7)25-42-32(40)43-34(5,6)33(2,3)4/h10-16,22,24H,8-9,17-21,23,25H2,1-7H3/b12-11- |
| InChIKey | LOABQIVRLSHOPO-QXMHVHEDSA-N |
| XLogP | 7.21 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.23 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|