C29H38ClN3O — CID 129274075
(Z)-3-[4-[1-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-[methyl(3-methylbut-3-enyl)amino]phenyl]prop-2-enal (PubChem CID 129274075) has the molecular formula C29H38ClN3O and a molecular weight of 480.10 g/mol. Its IUPAC name is (Z)-3-[4-[1-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-[methyl(3-methylbut-3-enyl)amino]phenyl]prop-2-enal.
| Compound Name | (Z)-3-[4-[1-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-[methyl(3-methylbut-3-enyl)amino]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 129274075 |
| Molecular Formula | C29H38ClN3O |
| Molecular Weight | 480.10 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (Z)-3-[4-[1-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-[methyl(3-methylbut-3-enyl)amino]phenyl]prop-2-enal |
| SMILES | C=C(C)CCN(C)c1cc(C(CC)N2CCN(c3cccc(Cl)c3C)CC2)ccc1/C=C\C=O |
| InChI | InChI=1S/C29H38ClN3O/c1-6-27(32-16-18-33(19-17-32)28-11-7-10-26(30)23(28)4)25-13-12-24(9-8-20-34)29(21-25)31(5)15-14-22(2)3/h7-13,20-21,27H,2,6,14-19H2,1,3-5H3/b9-8- |
| InChIKey | IGWNCJLHJGWXQZ-HJWRWDBZSA-N |
| XLogP | 6.54 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.10 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|