C11H16ClN — CID 123602210
3-chloro-N,2-dimethyl-N-propylaniline (PubChem CID 123602210) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-propylaniline.
| Compound Name | 3-chloro-N,2-dimethyl-N-propylaniline |
|---|---|
| PubChem CID | 123602210 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-propylaniline |
| SMILES | CCCN(C)c1cccc(Cl)c1C |
| InChI | InChI=1S/C11H16ClN/c1-4-8-13(3)11-7-5-6-10(12)9(11)2/h5-7H,4,8H2,1-3H3 |
| InChIKey | HFSNVGTUCMHTOV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |