C13H19Cl2N — CID 28946264
3-chloro-2-(chloromethyl)-N,N-dipropylaniline (PubChem CID 28946264) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is 3-chloro-2-(chloromethyl)-N,N-dipropylaniline.
| Compound Name | 3-chloro-2-(chloromethyl)-N,N-dipropylaniline |
|---|---|
| PubChem CID | 28946264 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-chloro-2-(chloromethyl)-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1cccc(Cl)c1CCl |
| InChI | InChI=1S/C13H19Cl2N/c1-3-8-16(9-4-2)13-7-5-6-12(15)11(13)10-14/h5-7H,3-4,8-10H2,1-2H3 |
| InChIKey | NRVYFHXSFVHTKG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|