C18H31ClN2 — CID 43281508
N,N-dibutyl-3-chloro-2-[(propan-2-ylamino)methyl]aniline (PubChem CID 43281508) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is N,N-dibutyl-3-chloro-2-[(propan-2-ylamino)methyl]aniline.
| Compound Name | N,N-dibutyl-3-chloro-2-[(propan-2-ylamino)methyl]aniline |
|---|---|
| PubChem CID | 43281508 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N,N-dibutyl-3-chloro-2-[(propan-2-ylamino)methyl]aniline |
| SMILES | CCCCN(CCCC)c1cccc(Cl)c1CNC(C)C |
| InChI | InChI=1S/C18H31ClN2/c1-5-7-12-21(13-8-6-2)18-11-9-10-17(19)16(18)14-20-15(3)4/h9-11,15,20H,5-8,12-14H2,1-4H3 |
| InChIKey | FEXNQRIZGZADSD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |