C18H23ClN2 — CID 63553262
3-chloro-N-methyl-N-(2-methylphenyl)-2-[(propan-2-ylamino)methyl]aniline (PubChem CID 63553262) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-(2-methylphenyl)-2-[(propan-2-ylamino)methyl]aniline.
| Compound Name | 3-chloro-N-methyl-N-(2-methylphenyl)-2-[(propan-2-ylamino)methyl]aniline |
|---|---|
| PubChem CID | 63553262 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-chloro-N-methyl-N-(2-methylphenyl)-2-[(propan-2-ylamino)methyl]aniline |
| SMILES | Cc1ccccc1N(C)c1cccc(Cl)c1CNC(C)C |
| InChI | InChI=1S/C18H23ClN2/c1-13(2)20-12-15-16(19)9-7-11-18(15)21(4)17-10-6-5-8-14(17)3/h5-11,13,20H,12H2,1-4H3 |
| InChIKey | LEFWLMQEACXOAG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |