C18H30ClN — CID 139723528
2-chloro-N,N-dihexylaniline (PubChem CID 139723528) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is 2-chloro-N,N-dihexylaniline.
| Compound Name | 2-chloro-N,N-dihexylaniline |
|---|---|
| PubChem CID | 139723528 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-chloro-N,N-dihexylaniline |
| SMILES | CCCCCCN(CCCCCC)c1ccccc1Cl |
| InChI | InChI=1S/C18H30ClN/c1-3-5-7-11-15-20(16-12-8-6-4-2)18-14-10-9-13-17(18)19/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | WZZSUVLERGRERT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|