C22H38N2O2 — CID 138786720
2-nitro-N,N-dioctylaniline (PubChem CID 138786720) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 2-nitro-N,N-dioctylaniline.
| Compound Name | 2-nitro-N,N-dioctylaniline |
|---|---|
| PubChem CID | 138786720 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 2-nitro-N,N-dioctylaniline |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H38N2O2/c1-3-5-7-9-11-15-19-23(20-16-12-10-8-6-4-2)21-17-13-14-18-22(21)24(25)26/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3 |
| InChIKey | IBKRGAMSYYSJDI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|