C26H44I2N2O2 — CID 10919462
N,N-didecyl-4,5-diiodo-2-nitroaniline (PubChem CID 10919462) has the molecular formula C26H44I2N2O2 and a molecular weight of 670.46 g/mol. Its IUPAC name is N,N-didecyl-4,5-diiodo-2-nitroaniline.
| Compound Name | N,N-didecyl-4,5-diiodo-2-nitroaniline |
|---|---|
| PubChem CID | 10919462 |
| Molecular Formula | C26H44I2N2O2 |
| Molecular Weight | 670.46 g/mol |
| Exact Mass | 670.15 |
| IUPAC Name | N,N-didecyl-4,5-diiodo-2-nitroaniline |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)c1cc(I)c(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H44I2N2O2/c1-3-5-7-9-11-13-15-17-19-29(20-18-16-14-12-10-8-6-4-2)25-21-23(27)24(28)22-26(25)30(31)32/h21-22H,3-20H2,1-2H3 |
| InChIKey | ZJDQSJPOTXIVAS-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.46 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|