C19H29N3O2S — CID 71318150
N,N-dihexyl-5-nitro-1,2-benzothiazol-6-amine (PubChem CID 71318150) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N,N-dihexyl-5-nitro-1,2-benzothiazol-6-amine.
| Compound Name | N,N-dihexyl-5-nitro-1,2-benzothiazol-6-amine |
|---|---|
| PubChem CID | 71318150 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N,N-dihexyl-5-nitro-1,2-benzothiazol-6-amine |
| SMILES | CCCCCCN(CCCCCC)c1cc2sncc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H29N3O2S/c1-3-5-7-9-11-21(12-10-8-6-4-2)17-14-19-16(15-20-25-19)13-18(17)22(23)24/h13-15H,3-12H2,1-2H3 |
| InChIKey | ZAEVPTIOSMAFAG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|