C20H34N2O2 — CID 139722585
N,N-diheptyl-2-nitroaniline (PubChem CID 139722585) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is N,N-diheptyl-2-nitroaniline.
| Compound Name | N,N-diheptyl-2-nitroaniline |
|---|---|
| PubChem CID | 139722585 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | N,N-diheptyl-2-nitroaniline |
| SMILES | CCCCCCCN(CCCCCCC)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H34N2O2/c1-3-5-7-9-13-17-21(18-14-10-8-6-4-2)19-15-11-12-16-20(19)22(23)24/h11-12,15-16H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey | VIXPIZSRURKFCZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|