C13H19Cl2N — CID 43572356
3-chloro-2-(chloromethyl)-N-methyl-N-pentan-2-ylaniline (PubChem CID 43572356) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is 3-chloro-2-(chloromethyl)-N-methyl-N-pentan-2-ylaniline.
| Compound Name | 3-chloro-2-(chloromethyl)-N-methyl-N-pentan-2-ylaniline |
|---|---|
| PubChem CID | 43572356 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-chloro-2-(chloromethyl)-N-methyl-N-pentan-2-ylaniline |
| SMILES | CCCC(C)N(C)c1cccc(Cl)c1CCl |
| InChI | InChI=1S/C13H19Cl2N/c1-4-6-10(2)16(3)13-8-5-7-12(15)11(13)9-14/h5,7-8,10H,4,6,9H2,1-3H3 |
| InChIKey | DPDPNLYOCBNKQH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|