C26H36ClN3OS — CID 134425331
2-[4-[4-[4-but-3-enyl-3-(dimethylamino)phenoxy]butyl]piperazin-1-yl]-6-chlorobenzenethiol (PubChem CID 134425331) has the molecular formula C26H36ClN3OS and a molecular weight of 474.11 g/mol. Its IUPAC name is 2-[4-[4-[4-but-3-enyl-3-(dimethylamino)phenoxy]butyl]piperazin-1-yl]-6-chlorobenzenethiol.
| Compound Name | 2-[4-[4-[4-but-3-enyl-3-(dimethylamino)phenoxy]butyl]piperazin-1-yl]-6-chlorobenzenethiol |
|---|---|
| PubChem CID | 134425331 |
| Molecular Formula | C26H36ClN3OS |
| Molecular Weight | 474.11 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-[4-[4-[4-but-3-enyl-3-(dimethylamino)phenoxy]butyl]piperazin-1-yl]-6-chlorobenzenethiol |
| SMILES | C=CCCc1ccc(OCCCCN2CCN(c3cccc(Cl)c3S)CC2)cc1N(C)C |
| InChI | InChI=1S/C26H36ClN3OS/c1-4-5-9-21-12-13-22(20-25(21)28(2)3)31-19-7-6-14-29-15-17-30(18-16-29)24-11-8-10-23(27)26(24)32/h4,8,10-13,20,32H,1,5-7,9,14-19H2,2-3H3 |
| InChIKey | UUCLIULRZFUCEE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 18.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.11 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|