C21H24Cl2N4O — CID 25072327
3-chloro-5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine (PubChem CID 25072327) has the molecular formula C21H24Cl2N4O and a molecular weight of 419.36 g/mol. Its IUPAC name is 3-chloro-5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine.
| Compound Name | 3-chloro-5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 25072327 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-chloro-5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
| SMILES | Clc1ccccc1N1CCN(CCCCOc2ccn3ncc(Cl)c3c2)CC1 |
| InChI | InChI=1S/C21H24Cl2N4O/c22-18-5-1-2-6-20(18)26-12-10-25(11-13-26)8-3-4-14-28-17-7-9-27-21(15-17)19(23)16-24-27/h1-2,5-7,9,15-16H,3-4,8,10-14H2 |
| InChIKey | NRECFKWBVQHHHJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|