C18H23ClN4O — CID 11473477
4-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethoxy]benzene-1,2-diamine (PubChem CID 11473477) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is 4-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethoxy]benzene-1,2-diamine.
| Compound Name | 4-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 11473477 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethoxy]benzene-1,2-diamine |
| SMILES | Nc1ccc(OCCN2CCN(c3ccccc3Cl)CC2)cc1N |
| InChI | InChI=1S/C18H23ClN4O/c19-15-3-1-2-4-18(15)23-9-7-22(8-10-23)11-12-24-14-5-6-16(20)17(21)13-14/h1-6,13H,7-12,20-21H2 |
| InChIKey | JCNKURMTBFUCCU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|