C33H47Cl2N3O7 — CID 166690893
N-[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-ethylphenyl]-N-[[3-[2-(2-methoxyethoxy)ethoxymethyl]oxiran-2-yl]oxymethyl]acetamide (PubChem CID 166690893) has the molecular formula C33H47Cl2N3O7 and a molecular weight of 668.66 g/mol. Its IUPAC name is N-[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-ethylphenyl]-N-[[3-[2-(2-methoxyethoxy)ethoxymethyl]oxiran-2-yl]oxymethyl]acetamide.
| Compound Name | N-[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-ethylphenyl]-N-[[3-[2-(2-methoxyethoxy)ethoxymethyl]oxiran-2-yl]oxymethyl]acetamide |
|---|---|
| PubChem CID | 166690893 |
| Molecular Formula | C33H47Cl2N3O7 |
| Molecular Weight | 668.66 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | N-[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-ethylphenyl]-N-[[3-[2-(2-methoxyethoxy)ethoxymethyl]oxiran-2-yl]oxymethyl]acetamide |
| SMILES | CCc1ccc(OCCCCN2CCN(c3cccc(Cl)c3Cl)CC2)cc1N(COC1OC1COCCOCCOC)C(C)=O |
| InChI | InChI=1S/C33H47Cl2N3O7/c1-4-26-10-11-27(43-17-6-5-12-36-13-15-37(16-14-36)29-9-7-8-28(34)32(29)35)22-30(26)38(25(2)39)24-44-33-31(45-33)23-42-21-20-41-19-18-40-3/h7-11,22,31,33H,4-6,12-21,23-24H2,1-3H3 |
| InChIKey | AAMWYBVLCIAUHG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|