C19H31ClN2 — CID 22957128
1-(3-chloro-2-methylphenyl)-4-(5,5-dimethylhexyl)piperazine (PubChem CID 22957128) has the molecular formula C19H31ClN2 and a molecular weight of 322.92 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-4-(5,5-dimethylhexyl)piperazine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-4-(5,5-dimethylhexyl)piperazine |
|---|---|
| PubChem CID | 22957128 |
| Molecular Formula | C19H31ClN2 |
| Molecular Weight | 322.92 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-4-(5,5-dimethylhexyl)piperazine |
| SMILES | Cc1c(Cl)cccc1N1CCN(CCCCC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H31ClN2/c1-16-17(20)8-7-9-18(16)22-14-12-21(13-15-22)11-6-5-10-19(2,3)4/h7-9H,5-6,10-15H2,1-4H3 |
| InChIKey | IYFGXCZCVQTEFV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.92 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|