C22H27ClN6O — CID 143226899
N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide (PubChem CID 143226899) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143226899 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide |
| SMILES | Cc1c(Cl)cccc1N1CCN(CCCCNC(=O)c2nc3ncccc3[nH]2)CC1 |
| InChI | InChI=1S/C22H27ClN6O/c1-16-17(23)6-4-8-19(16)29-14-12-28(13-15-29)11-3-2-9-25-22(30)21-26-18-7-5-10-24-20(18)27-21/h4-8,10H,2-3,9,11-15H2,1H3,(H,25,30)(H,24,26,27) |
| InChIKey | MFEJNXFTSVKVPX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|