C30H34Cl3N3O — CID 21202835
N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;dihydrochloride (PubChem CID 21202835) has the molecular formula C30H34Cl3N3O and a molecular weight of 558.98 g/mol. Its IUPAC name is N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;dihydrochloride.
| Compound Name | N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 21202835 |
| Molecular Formula | C30H34Cl3N3O |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | N-[4-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;dihydrochloride |
| SMILES | Cc1c(Cl)cccc1N1CCN(CCCCNC(=O)c2ccc3cc4ccccc4cc3c2)CC1.Cl.Cl |
| InChI | InChI=1S/C30H32ClN3O.2ClH/c1-22-28(31)9-6-10-29(22)34-17-15-33(16-18-34)14-5-4-13-32-30(35)26-12-11-25-19-23-7-2-3-8-24(23)20-27(25)21-26;;/h2-3,6-12,19-21H,4-5,13-18H2,1H3,(H,32,35);2*1H |
| InChIKey | BJFIQRFOAXIVCV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|