C20H23ClN4 — CID 21481016
3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-2H-indazole (PubChem CID 21481016) has the molecular formula C20H23ClN4 and a molecular weight of 354.88 g/mol. Its IUPAC name is 3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-2H-indazole.
| Compound Name | 3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-2H-indazole |
|---|---|
| PubChem CID | 21481016 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-2H-indazole |
| SMILES | Cc1c(Cl)cccc1N1CCN(CCc2[nH]nc3ccccc23)CC1 |
| InChI | InChI=1S/C20H23ClN4/c1-15-17(21)6-4-8-20(15)25-13-11-24(12-14-25)10-9-19-16-5-2-3-7-18(16)22-23-19/h2-8H,9-14H2,1H3,(H,22,23) |
| InChIKey | AQXDSOZVFFCRGW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |