C23H28Cl2N4O2 — CID 139812432
3-(chloromethyl)-1-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-5,6-dimethoxyindazole (PubChem CID 139812432) has the molecular formula C23H28Cl2N4O2 and a molecular weight of 463.41 g/mol. Its IUPAC name is 3-(chloromethyl)-1-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-5,6-dimethoxyindazole.
| Compound Name | 3-(chloromethyl)-1-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-5,6-dimethoxyindazole |
|---|---|
| PubChem CID | 139812432 |
| Molecular Formula | C23H28Cl2N4O2 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-(chloromethyl)-1-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-5,6-dimethoxyindazole |
| SMILES | COc1cc2c(CCl)nn(CCN3CCN(c4cccc(Cl)c4C)CC3)c2cc1OC |
| InChI | InChI=1S/C23H28Cl2N4O2/c1-16-18(25)5-4-6-20(16)28-10-7-27(8-11-28)9-12-29-21-14-23(31-3)22(30-2)13-17(21)19(15-24)26-29/h4-6,13-14H,7-12,15H2,1-3H3 |
| InChIKey | JFVAXJRNWUGLJJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|