C23H21N5O4 — CID 141025475
10-[2-(2H-indazol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione (PubChem CID 141025475) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 10-[2-(2H-indazol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione.
| Compound Name | 10-[2-(2H-indazol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
|---|---|
| PubChem CID | 141025475 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 10-[2-(2H-indazol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
| SMILES | O=C1OC2(CN(c3cccc4[nH]ccc34)CCN2CCc2[nH]nc3ccccc23)OC1=O |
| InChI | InChI=1S/C23H21N5O4/c29-21-22(30)32-23(31-21)14-27(20-7-3-6-17-16(20)8-10-24-17)12-13-28(23)11-9-19-15-4-1-2-5-18(15)25-26-19/h1-8,10,24H,9,11-14H2,(H,25,26) |
| InChIKey | GSFGSRQYLJZZOE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|