C30H38Cl2N4O5 — CID 134425314
[2-[(E)-2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]prop-1-enyl]-3-ethenyl-6-oxo-1-pyridinyl]methyl morpholine-4-carboxylate (PubChem CID 134425314) has the molecular formula C30H38Cl2N4O5 and a molecular weight of 605.56 g/mol. Its IUPAC name is [2-[(E)-2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]prop-1-enyl]-3-ethenyl-6-oxo-1-pyridinyl]methyl morpholine-4-carboxylate.
| Compound Name | [2-[(E)-2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]prop-1-enyl]-3-ethenyl-6-oxo-1-pyridinyl]methyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 134425314 |
| Molecular Formula | C30H38Cl2N4O5 |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | [2-[(E)-2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]prop-1-enyl]-3-ethenyl-6-oxo-1-pyridinyl]methyl morpholine-4-carboxylate |
| SMILES | C=Cc1ccc(=O)n(COC(=O)N2CCOCC2)c1/C=C(\C)OCCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C30H38Cl2N4O5/c1-3-24-9-10-28(37)36(22-41-30(38)35-16-19-39-20-17-35)27(24)21-23(2)40-18-5-4-11-33-12-14-34(15-13-33)26-8-6-7-25(31)29(26)32/h3,6-10,21H,1,4-5,11-20,22H2,2H3/b23-21+ |
| InChIKey | XVYVSSBAJWAAIY-XTQSDGFTSA-N |
| XLogP | 5.20 |
| TPSA | 76.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|