C23H28Cl2N6O — CID 69240440
1-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-pyrazolo[1,5-a]pyridin-5-ylurea (PubChem CID 69240440) has the molecular formula C23H28Cl2N6O and a molecular weight of 475.42 g/mol. Its IUPAC name is 1-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-pyrazolo[1,5-a]pyridin-5-ylurea.
| Compound Name | 1-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-pyrazolo[1,5-a]pyridin-5-ylurea |
|---|---|
| PubChem CID | 69240440 |
| Molecular Formula | C23H28Cl2N6O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-pyrazolo[1,5-a]pyridin-5-ylurea |
| SMILES | NC(=O)N(CCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1ccn2nccc2c1 |
| InChI | InChI=1S/C23H28Cl2N6O/c24-20-5-4-6-21(22(20)25)29-15-13-28(14-16-29)10-2-1-3-11-30(23(26)32)18-8-12-31-19(17-18)7-9-27-31/h4-9,12,17H,1-3,10-11,13-16H2,(H2,26,32) |
| InChIKey | SVGFMDLESCTKSV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|