About 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine
1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine (PubChem CID 142689415) has the molecular formula C21H24Cl2N4
and a molecular weight of 403.36 g/mol. Its IUPAC name is 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine |
| PubChem CID | 142689415 |
| Molecular Formula | C21H24Cl2N4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine |
| SMILES | Clc1cccc(N2CCN(CCCCn3ccc4cccnc43)CC2)c1Cl |
| InChI | InChI=1S/C21H24Cl2N4/c22-18-6-3-7-19(20(18)23)26-15-13-25(14-16-26)10-1-2-11-27-12-8-17-5-4-9-24-21(17)27/h3-9,12H,1-2,10-11,13-16H2 |
| InChIKey | OITZOWLJGXHLBA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine?
The IUPAC name of 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine (CID 142689415) is 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine?
The canonical SMILES for 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine is Clc1cccc(N2CCN(CCCCn3ccc4cccnc43)CC2)c1Cl.
What is the InChIKey of 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine?
The InChIKey is OITZOWLJGXHLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Cl2N4/c22-18-6-3-7-19(20(18)23)26-15-13-25(14-16-26)10-1-2-11-27-12-8-17-5-4-9-24-21(17)27/h3-9,12H,1-2,10-11,13-16H2.
What are the key properties of 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine?
1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine has a molecular weight of 403.36 g/mol, XLogP of 4.95, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 142689415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).