C22H24Cl2N4O2S — CID 71574208
N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]quinoline-6-sulfonamide (PubChem CID 71574208) has the molecular formula C22H24Cl2N4O2S and a molecular weight of 479.43 g/mol. Its IUPAC name is N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]quinoline-6-sulfonamide.
| Compound Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 71574208 |
| Molecular Formula | C22H24Cl2N4O2S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]quinoline-6-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C22H24Cl2N4O2S/c23-19-5-1-6-21(22(19)24)28-14-12-27(13-15-28)11-3-10-26-31(29,30)18-7-8-20-17(16-18)4-2-9-25-20/h1-2,4-9,16,26H,3,10-15H2 |
| InChIKey | UNXSKPWKGQDDCI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|