C25H27ClN4O4S — CID 66801175
7-chloro-N-[3-[4-(3-oxo-4H-1,4-benzoxazin-8-yl)piperazin-1-yl]propyl]naphthalene-2-sulfonamide (PubChem CID 66801175) has the molecular formula C25H27ClN4O4S and a molecular weight of 515.04 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-(3-oxo-4H-1,4-benzoxazin-8-yl)piperazin-1-yl]propyl]naphthalene-2-sulfonamide.
| Compound Name | 7-chloro-N-[3-[4-(3-oxo-4H-1,4-benzoxazin-8-yl)piperazin-1-yl]propyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 66801175 |
| Molecular Formula | C25H27ClN4O4S |
| Molecular Weight | 515.04 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 7-chloro-N-[3-[4-(3-oxo-4H-1,4-benzoxazin-8-yl)piperazin-1-yl]propyl]naphthalene-2-sulfonamide |
| SMILES | O=C1COc2c(cccc2N2CCN(CCCNS(=O)(=O)c3ccc4ccc(Cl)cc4c3)CC2)N1 |
| InChI | InChI=1S/C25H27ClN4O4S/c26-20-7-5-18-6-8-21(16-19(18)15-20)35(32,33)27-9-2-10-29-11-13-30(14-12-29)23-4-1-3-22-25(23)34-17-24(31)28-22/h1,3-8,15-16,27H,2,9-14,17H2,(H,28,31) |
| InChIKey | QLZXBTVREFQQNS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|