About 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol
1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol (PubChem CID 122181005) has the molecular formula C25H26Cl2N6O
and a molecular weight of 497.43 g/mol. Its IUPAC name is 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol.
Molecular Properties
| Compound Name | 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol |
| PubChem CID | 122181005 |
| Molecular Formula | C25H26Cl2N6O |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol |
| SMILES | OC(CCn1cc(-c2ccc3ncccc3c2)nn1)CN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C25H26Cl2N6O/c26-21-4-1-5-24(25(21)27)32-13-11-31(12-14-32)16-20(34)8-10-33-17-23(29-30-33)19-6-7-22-18(15-19)3-2-9-28-22/h1-7,9,15,17,20,34H,8,10-14,16H2 |
| InChIKey | VVNKMNCWRHQTDH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol?
The IUPAC name of 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol (CID 122181005) is 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol.
What is the SMILES notation for 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol?
The canonical SMILES for 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol is OC(CCn1cc(-c2ccc3ncccc3c2)nn1)CN1CCN(c2cccc(Cl)c2Cl)CC1.
What is the InChIKey of 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol?
The InChIKey is VVNKMNCWRHQTDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26Cl2N6O/c26-21-4-1-5-24(25(21)27)32-13-11-31(12-14-32)16-20(34)8-10-33-17-23(29-30-33)19-6-7-22-18(15-19)3-2-9-28-22/h1-7,9,15,17,20,34H,8,10-14,16H2.
What are the key properties of 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol?
1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol has a molecular weight of 497.43 g/mol, XLogP of 4.37, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-(4-quinolin-6-yltriazol-1-yl)butan-2-ol is sourced from PubChem (CID 122181005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).