C26H28Cl2N4O — CID 162344971
5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-N-(4-pyridin-2-ylphenyl)pentanamide (PubChem CID 162344971) has the molecular formula C26H28Cl2N4O and a molecular weight of 483.44 g/mol. Its IUPAC name is 5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-N-(4-pyridin-2-ylphenyl)pentanamide.
| Compound Name | 5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-N-(4-pyridin-2-ylphenyl)pentanamide |
|---|---|
| PubChem CID | 162344971 |
| Molecular Formula | C26H28Cl2N4O |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-N-(4-pyridin-2-ylphenyl)pentanamide |
| SMILES | O=C(CCCCN1CCN(c2cccc(Cl)c2Cl)CC1)Nc1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C26H28Cl2N4O/c27-22-6-5-8-24(26(22)28)32-18-16-31(17-19-32)15-4-2-9-25(33)30-21-12-10-20(11-13-21)23-7-1-3-14-29-23/h1,3,5-8,10-14H,2,4,9,15-19H2,(H,30,33) |
| InChIKey | IOXVASZCJRRQKL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|