C20H24Cl2N4O — CID 11350302
2-[(E)-5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentylideneamino]pyridin-3-ol (PubChem CID 11350302) has the molecular formula C20H24Cl2N4O and a molecular weight of 407.35 g/mol. Its IUPAC name is 2-[(E)-5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentylideneamino]pyridin-3-ol.
| Compound Name | 2-[(E)-5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentylideneamino]pyridin-3-ol |
|---|---|
| PubChem CID | 11350302 |
| Molecular Formula | C20H24Cl2N4O |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[(E)-5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentylideneamino]pyridin-3-ol |
| SMILES | Oc1cccnc1/N=C/CCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C20H24Cl2N4O/c21-16-6-4-7-17(19(16)22)26-14-12-25(13-15-26)11-3-1-2-9-23-20-18(27)8-5-10-24-20/h4-10,27H,1-3,11-15H2/b23-9+ |
| InChIKey | RWJLLBWXQUIDKJ-NUGSKGIGSA-N |
| XLogP | 4.79 |
| TPSA | 51.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|