C19H22Cl2N4O — CID 71188435
2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butylideneamino]-2H-pyridin-3-one (PubChem CID 71188435) has the molecular formula C19H22Cl2N4O and a molecular weight of 393.32 g/mol. Its IUPAC name is 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butylideneamino]-2H-pyridin-3-one.
| Compound Name | 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butylideneamino]-2H-pyridin-3-one |
|---|---|
| PubChem CID | 71188435 |
| Molecular Formula | C19H22Cl2N4O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butylideneamino]-2H-pyridin-3-one |
| SMILES | O=C1C=CC=NC1N=CCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C19H22Cl2N4O/c20-15-5-3-6-16(18(15)21)25-13-11-24(12-14-25)10-2-1-8-22-19-17(26)7-4-9-23-19/h3-9,19H,1-2,10-14H2 |
| InChIKey | YNWJWFHVEIQXQD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|