C22H22Cl2FN3O2 — CID 53248155
2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione (PubChem CID 53248155) has the molecular formula C22H22Cl2FN3O2 and a molecular weight of 450.34 g/mol. Its IUPAC name is 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53248155 |
| Molecular Formula | C22H22Cl2FN3O2 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC(F)CN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C22H22Cl2FN3O2/c23-18-6-3-7-19(20(18)24)27-12-10-26(11-13-27)14-15(25)8-9-28-21(29)16-4-1-2-5-17(16)22(28)30/h1-7,15H,8-14H2 |
| InChIKey | ADPBLMNKJHDION-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|