C27H29Cl2N3O2 — CID 155034814
2-[5-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]isoindole-1,3-dione (PubChem CID 155034814) has the molecular formula C27H29Cl2N3O2 and a molecular weight of 498.45 g/mol. Its IUPAC name is 2-[5-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155034814 |
| Molecular Formula | C27H29Cl2N3O2 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[5-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CC2CC(CN3CCN(c4cccc(Cl)c4Cl)CC3)CC2C1 |
| InChI | InChI=1S/C27H29Cl2N3O2/c28-23-6-3-7-24(25(23)29)31-10-8-30(9-11-31)16-17-12-18-14-20(15-19(18)13-17)32-26(33)21-4-1-2-5-22(21)27(32)34/h1-7,17-20H,8-16H2 |
| InChIKey | CFMPPCQPRXTDLS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|