C25H30ClN3O4 — CID 172697434
2-[(3S)-4-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]-3-hydroxybutyl]isoindole-1,3-dione (PubChem CID 172697434) has the molecular formula C25H30ClN3O4 and a molecular weight of 471.99 g/mol. Its IUPAC name is 2-[(3S)-4-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]-3-hydroxybutyl]isoindole-1,3-dione.
| Compound Name | 2-[(3S)-4-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]-3-hydroxybutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172697434 |
| Molecular Formula | C25H30ClN3O4 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[(3S)-4-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]-3-hydroxybutyl]isoindole-1,3-dione |
| SMILES | CCc1cc(Cl)c(OC)c(N2CCN(C[C@@H](O)CCN3C(=O)c4ccccc4C3=O)CC2)c1 |
| InChI | InChI=1S/C25H30ClN3O4/c1-3-17-14-21(26)23(33-2)22(15-17)28-12-10-27(11-13-28)16-18(30)8-9-29-24(31)19-6-4-5-7-20(19)25(29)32/h4-7,14-15,18,30H,3,8-13,16H2,1-2H3/t18-/m0/s1 |
| InChIKey | CMTUKMHXCYUJJO-SFHVURJKSA-N |
| XLogP | 3.08 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|