C27H35ClN4O2 — CID 165112161
N-[5-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]pentyl]-1H-indole-2-carboxamide (PubChem CID 165112161) has the molecular formula C27H35ClN4O2 and a molecular weight of 483.06 g/mol. Its IUPAC name is N-[5-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]pentyl]-1H-indole-2-carboxamide.
| Compound Name | N-[5-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]pentyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 165112161 |
| Molecular Formula | C27H35ClN4O2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | N-[5-[4-(3-chloro-5-ethyl-2-methoxyphenyl)piperazin-1-yl]pentyl]-1H-indole-2-carboxamide |
| SMILES | CCc1cc(Cl)c(OC)c(N2CCN(CCCCCNC(=O)c3cc4ccccc4[nH]3)CC2)c1 |
| InChI | InChI=1S/C27H35ClN4O2/c1-3-20-17-22(28)26(34-2)25(18-20)32-15-13-31(14-16-32)12-8-4-7-11-29-27(33)24-19-21-9-5-6-10-23(21)30-24/h5-6,9-10,17-19,30H,3-4,7-8,11-16H2,1-2H3,(H,29,33) |
| InChIKey | BIONXCOSPRCKKH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|