C24H25Cl2N5O — CID 10367438
5-cyano-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-2-carboxamide (PubChem CID 10367438) has the molecular formula C24H25Cl2N5O and a molecular weight of 470.40 g/mol. Its IUPAC name is 5-cyano-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-2-carboxamide.
| Compound Name | 5-cyano-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10367438 |
| Molecular Formula | C24H25Cl2N5O |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 5-cyano-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-2-carboxamide |
| SMILES | N#Cc1ccc2[nH]c(C(=O)NCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2c1 |
| InChI | InChI=1S/C24H25Cl2N5O/c25-19-4-3-5-22(23(19)26)31-12-10-30(11-13-31)9-2-1-8-28-24(32)21-15-18-14-17(16-27)6-7-20(18)29-21/h3-7,14-15,29H,1-2,8-13H2,(H,28,32) |
| InChIKey | ZYAJMPAYSHYJKT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|