C24H27ClFN3O2 — CID 172803085
2-[(3R)-4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione (PubChem CID 172803085) has the molecular formula C24H27ClFN3O2 and a molecular weight of 443.95 g/mol. Its IUPAC name is 2-[(3R)-4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione.
| Compound Name | 2-[(3R)-4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172803085 |
| Molecular Formula | C24H27ClFN3O2 |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[(3R)-4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-3-fluorobutyl]isoindole-1,3-dione |
| SMILES | CCc1cccc(N2CCN(C[C@H](F)CCN3C(=O)c4ccccc4C3=O)CC2)c1Cl |
| InChI | InChI=1S/C24H27ClFN3O2/c1-2-17-6-5-9-21(22(17)25)28-14-12-27(13-15-28)16-18(26)10-11-29-23(30)19-7-3-4-8-20(19)24(29)31/h3-9,18H,2,10-16H2,1H3/t18-/m1/s1 |
| InChIKey | RDEMJICTJXPWFQ-GOSISDBHSA-N |
| XLogP | 4.05 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|