C26H31BrN4O3 — CID 11663681
1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]urea (PubChem CID 11663681) has the molecular formula C26H31BrN4O3 and a molecular weight of 527.46 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]urea.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 11663681 |
| Molecular Formula | C26H31BrN4O3 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]urea |
| SMILES | NC(=O)N(CCCCN1CCN(c2cccc3c2OCCC3)CC1)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C26H31BrN4O3/c27-21-8-9-23-20(17-21)18-24(34-23)31(26(28)32)11-2-1-10-29-12-14-30(15-13-29)22-7-3-5-19-6-4-16-33-25(19)22/h3,5,7-9,17-18H,1-2,4,6,10-16H2,(H2,28,32) |
| InChIKey | IYXWOXSFRKKSQL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|