C27H33ClN4O2S — CID 11519138
1-(3-chloro-1-benzothiophen-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)piperazin-1-yl]butyl]urea (PubChem CID 11519138) has the molecular formula C27H33ClN4O2S and a molecular weight of 513.11 g/mol. Its IUPAC name is 1-(3-chloro-1-benzothiophen-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)piperazin-1-yl]butyl]urea.
| Compound Name | 1-(3-chloro-1-benzothiophen-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)piperazin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 11519138 |
| Molecular Formula | C27H33ClN4O2S |
| Molecular Weight | 513.11 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 1-(3-chloro-1-benzothiophen-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)piperazin-1-yl]butyl]urea |
| SMILES | NC(=O)N(CCCCN1CCN(c2cccc3c2OCCCC3)CC1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C27H33ClN4O2S/c28-24-21-10-1-2-12-23(21)35-26(24)32(27(29)33)14-5-4-13-30-15-17-31(18-16-30)22-11-7-9-20-8-3-6-19-34-25(20)22/h1-2,7,9-12H,3-6,8,13-19H2,(H2,29,33) |
| InChIKey | UNTYJADLCQWAFJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.11 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|