C25H31N5O2 — CID 11611787
1-[4-[4-(2,3-dihydro-1-benzofuran-7-yl)piperazin-1-yl]butyl]-1-(1H-indol-2-yl)urea (PubChem CID 11611787) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-[4-[4-(2,3-dihydro-1-benzofuran-7-yl)piperazin-1-yl]butyl]-1-(1H-indol-2-yl)urea.
| Compound Name | 1-[4-[4-(2,3-dihydro-1-benzofuran-7-yl)piperazin-1-yl]butyl]-1-(1H-indol-2-yl)urea |
|---|---|
| PubChem CID | 11611787 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[4-[4-(2,3-dihydro-1-benzofuran-7-yl)piperazin-1-yl]butyl]-1-(1H-indol-2-yl)urea |
| SMILES | NC(=O)N(CCCCN1CCN(c2cccc3c2OCC3)CC1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H31N5O2/c26-25(31)30(23-18-20-6-1-2-8-21(20)27-23)12-4-3-11-28-13-15-29(16-14-28)22-9-5-7-19-10-17-32-24(19)22/h1-2,5-9,18,27H,3-4,10-17H2,(H2,26,31) |
| InChIKey | MUVCPNWSVFHGEE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|