C26H32N4O3 — CID 69253173
[2-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]-1-benzofuran-3-yl]urea (PubChem CID 69253173) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is [2-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]-1-benzofuran-3-yl]urea.
| Compound Name | [2-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]-1-benzofuran-3-yl]urea |
|---|---|
| PubChem CID | 69253173 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [2-[4-[4-(3,4-dihydro-2H-chromen-8-yl)piperazin-1-yl]butyl]-1-benzofuran-3-yl]urea |
| SMILES | NC(=O)Nc1c(CCCCN2CCN(c3cccc4c3OCCC4)CC2)oc2ccccc12 |
| InChI | InChI=1S/C26H32N4O3/c27-26(31)28-24-20-9-1-2-11-22(20)33-23(24)12-3-4-13-29-14-16-30(17-15-29)21-10-5-7-19-8-6-18-32-25(19)21/h1-2,5,7,9-11H,3-4,6,8,12-18H2,(H3,27,28,31) |
| InChIKey | JKNBVWVDCLPRAU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|