C28H36N4O2S — CID 69253388
[2-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]-1-benzothiophen-3-yl]urea (PubChem CID 69253388) has the molecular formula C28H36N4O2S and a molecular weight of 492.69 g/mol. Its IUPAC name is [2-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]-1-benzothiophen-3-yl]urea.
| Compound Name | [2-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]-1-benzothiophen-3-yl]urea |
|---|---|
| PubChem CID | 69253388 |
| Molecular Formula | C28H36N4O2S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | [2-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]-1-benzothiophen-3-yl]urea |
| SMILES | NC(=O)Nc1c(CCCCN2CCCN(c3cccc4c3OCCCC4)CC2)sc2ccccc12 |
| InChI | InChI=1S/C28H36N4O2S/c29-28(33)30-26-22-11-1-2-13-24(22)35-25(26)14-3-5-15-31-16-8-17-32(19-18-31)23-12-7-10-21-9-4-6-20-34-27(21)23/h1-2,7,10-13H,3-6,8-9,14-20H2,(H3,29,30,33) |
| InChIKey | UZMDPDSPQUTALM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|